C19H23FO3S — CID 57123682
1-benzylsulfanyl-3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]benzene (PubChem CID 57123682) has the molecular formula C19H23FO3S and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-benzylsulfanyl-3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]benzene.
| Compound Name | 1-benzylsulfanyl-3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]benzene |
|---|---|
| PubChem CID | 57123682 |
| Molecular Formula | C19H23FO3S |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-benzylsulfanyl-3-fluoro-5-[(1S,2R)-1,2,3-trimethoxypropyl]benzene |
| SMILES | COC[C@@H](OC)[C@@H](OC)c1cc(F)cc(SCc2ccccc2)c1 |
| InChI | InChI=1S/C19H23FO3S/c1-21-12-18(22-2)19(23-3)15-9-16(20)11-17(10-15)24-13-14-7-5-4-6-8-14/h4-11,18-19H,12-13H2,1-3H3/t18-,19+/m1/s1 |
| InChIKey | GRLVNPRZFAWTMN-MOPGFXCFSA-N |
| XLogP | 4.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |