C20H21N3O3S2 — CID 57123699
N-hydroxy-2-[(2S)-2-[5-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]thiophen-2-yl]thian-2-yl]acetamide (PubChem CID 57123699) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is N-hydroxy-2-[(2S)-2-[5-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]thiophen-2-yl]thian-2-yl]acetamide.
| Compound Name | N-hydroxy-2-[(2S)-2-[5-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]thiophen-2-yl]thian-2-yl]acetamide |
|---|---|
| PubChem CID | 57123699 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | N-hydroxy-2-[(2S)-2-[5-[4-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]thiophen-2-yl]thian-2-yl]acetamide |
| SMILES | Cc1nc(-c2ccc(-c3ccc([C@@]4(CC(=O)NO)CCCCS4)s3)cc2)no1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-13-21-19(23-26-13)15-6-4-14(5-7-15)16-8-9-17(28-16)20(12-18(24)22-25)10-2-3-11-27-20/h4-9,25H,2-3,10-12H2,1H3,(H,22,24)/t20-/m0/s1 |
| InChIKey | DDJVQSMRDSVCKU-FQEVSTJZSA-N |
| XLogP | 4.78 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|