C29H35F6NO3 — CID 57123742
[(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl 3,5-bis(trifluoromethyl)benzoate (PubChem CID 57123742) has the molecular formula C29H35F6NO3 and a molecular weight of 559.59 g/mol. Its IUPAC name is [(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl 3,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl 3,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 57123742 |
| Molecular Formula | C29H35F6NO3 |
| Molecular Weight | 559.59 g/mol |
| Exact Mass | 559.25 |
| IUPAC Name | [(3aS,3bS,9aR,9bR,11aS)-6,9a,11a-trimethyl-7-oxo-2,3,3a,3b,4,5,5a,8,9,9b,10,11-dodecahydro-1H-indeno[5,4-f]quinolin-1-yl]methyl 3,5-bis(trifluoromethyl)benzoate |
| SMILES | CN1C(=O)CC[C@@]2(C)C1CC[C@@H]1[C@H]2CC[C@]2(C)C(COC(=O)c3cc(C(F)(F)F)cc(C(F)(F)F)c3)CC[C@@H]12 |
| InChI | InChI=1S/C29H35F6NO3/c1-26-10-8-22-20(5-7-23-27(22,2)11-9-24(37)36(23)3)21(26)6-4-17(26)15-39-25(38)16-12-18(28(30,31)32)14-19(13-16)29(33,34)35/h12-14,17,20-23H,4-11,15H2,1-3H3/t17?,20-,21-,22+,23?,26+,27+/m0/s1 |
| InChIKey | SCHNXSZBEQVLRO-XETJYNKKSA-N |
| XLogP | 7.36 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.59 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |