About (7S)-4-methoxy-7-methylazepane-2,5,6-trione
(7S)-4-methoxy-7-methylazepane-2,5,6-trione (PubChem CID 57123881) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is (7S)-4-methoxy-7-methylazepane-2,5,6-trione.
Molecular Properties
| Compound Name | (7S)-4-methoxy-7-methylazepane-2,5,6-trione |
| PubChem CID | 57123881 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | (7S)-4-methoxy-7-methylazepane-2,5,6-trione |
| SMILES | COC1CC(=O)N[C@@H](C)C(=O)C1=O |
| InChI | InChI=1S/C8H11NO4/c1-4-7(11)8(12)5(13-2)3-6(10)9-4/h4-5H,3H2,1-2H3,(H,9,10)/t4-,5?/m0/s1 |
| InChIKey | JKFJTQLQRYPRSO-ROLXFIACSA-N |
| XLogP | -0.95 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze (7S)-4-methoxy-7-methylazepane-2,5,6-trione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7S)-4-methoxy-7-methylazepane-2,5,6-trione?
The IUPAC name of (7S)-4-methoxy-7-methylazepane-2,5,6-trione (CID 57123881) is (7S)-4-methoxy-7-methylazepane-2,5,6-trione.
What is the SMILES notation for (7S)-4-methoxy-7-methylazepane-2,5,6-trione?
The canonical SMILES for (7S)-4-methoxy-7-methylazepane-2,5,6-trione is COC1CC(=O)N[C@@H](C)C(=O)C1=O.
What is the InChIKey of (7S)-4-methoxy-7-methylazepane-2,5,6-trione?
The InChIKey is JKFJTQLQRYPRSO-ROLXFIACSA-N. The full InChI is InChI=1S/C8H11NO4/c1-4-7(11)8(12)5(13-2)3-6(10)9-4/h4-5H,3H2,1-2H3,(H,9,10)/t4-,5?/m0/s1.
What are the key properties of (7S)-4-methoxy-7-methylazepane-2,5,6-trione?
(7S)-4-methoxy-7-methylazepane-2,5,6-trione has a molecular weight of 185.18 g/mol, XLogP of -0.95, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7S)-4-methoxy-7-methylazepane-2,5,6-trione is sourced from PubChem (CID 57123881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).