About 2-methyldecane-1-thiol
2-methyldecane-1-thiol (PubChem CID 57124133) has the molecular formula C11H24S
and a molecular weight of 188.38 g/mol. Its IUPAC name is 2-methyldecane-1-thiol.
Molecular Properties
| Compound Name | 2-methyldecane-1-thiol |
| PubChem CID | 57124133 |
| Molecular Formula | C11H24S |
| Molecular Weight | 188.38 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 2-methyldecane-1-thiol |
| SMILES | CCCCCCCCC(C)CS |
| InChI | InChI=1S/C11H24S/c1-3-4-5-6-7-8-9-11(2)10-12/h11-12H,3-10H2,1-2H3 |
| InChIKey | OFMVEYKTTUFGKA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.38 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methyldecane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyldecane-1-thiol?
The IUPAC name of 2-methyldecane-1-thiol (CID 57124133) is 2-methyldecane-1-thiol.
What is the SMILES notation for 2-methyldecane-1-thiol?
The canonical SMILES for 2-methyldecane-1-thiol is CCCCCCCCC(C)CS.
What is the InChIKey of 2-methyldecane-1-thiol?
The InChIKey is OFMVEYKTTUFGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24S/c1-3-4-5-6-7-8-9-11(2)10-12/h11-12H,3-10H2,1-2H3.
What are the key properties of 2-methyldecane-1-thiol?
2-methyldecane-1-thiol has a molecular weight of 188.38 g/mol, XLogP of 4.30, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyldecane-1-thiol is sourced from PubChem (CID 57124133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).