C18H20N6O6 — CID 57124299
bis[5-(3-methyl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl] oxalate (PubChem CID 57124299) has the molecular formula C18H20N6O6 and a molecular weight of 416.39 g/mol. Its IUPAC name is bis[5-(3-methyl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl] oxalate.
| Compound Name | bis[5-(3-methyl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl] oxalate |
|---|---|
| PubChem CID | 57124299 |
| Molecular Formula | C18H20N6O6 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | bis[5-(3-methyl-1,2,4-oxadiazol-5-yl)-3,6-dihydro-2H-pyridin-1-yl] oxalate |
| SMILES | Cc1noc(C2=CCCN(OC(=O)C(=O)ON3CCC=C(c4nc(C)no4)C3)C2)n1 |
| InChI | InChI=1S/C18H20N6O6/c1-11-19-15(27-21-11)13-5-3-7-23(9-13)29-17(25)18(26)30-24-8-4-6-14(10-24)16-20-12(2)22-28-16/h5-6H,3-4,7-10H2,1-2H3 |
| InChIKey | GINFJBXFRGMFCB-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 136.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|