About 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate
1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 57124489) has the molecular formula C14H12BrNO4S
and a molecular weight of 370.22 g/mol. Its IUPAC name is 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
Molecular Properties
| Compound Name | 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| PubChem CID | 57124489 |
| Molecular Formula | C14H12BrNO4S |
| Molecular Weight | 370.22 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC(OC(=O)C1=CS[C@@H]2[C@@H](Br)C(=O)N12)Oc1ccccc1 |
| InChI | InChI=1S/C14H12BrNO4S/c1-8(19-9-5-3-2-4-6-9)20-14(18)10-7-21-13-11(15)12(17)16(10)13/h2-8,11,13H,1H3/t8?,11-,13+/m0/s1 |
| InChIKey | HCJPKXWEHGIYQX-XIWYHIBGSA-N |
| XLogP | 2.47 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The IUPAC name of 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (CID 57124489) is 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
What is the SMILES notation for 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The canonical SMILES for 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is CC(OC(=O)C1=CS[C@@H]2[C@@H](Br)C(=O)N12)Oc1ccccc1.
What is the InChIKey of 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
The InChIKey is HCJPKXWEHGIYQX-XIWYHIBGSA-N. The full InChI is InChI=1S/C14H12BrNO4S/c1-8(19-9-5-3-2-4-6-9)20-14(18)10-7-21-13-11(15)12(17)16(10)13/h2-8,11,13H,1H3/t8?,11-,13+/m0/s1.
What are the key properties of 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate?
1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate has a molecular weight of 370.22 g/mol, XLogP of 2.47, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxyethyl (5R,6S)-6-bromo-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate is sourced from PubChem (CID 57124489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).