C16H22O8 — CID 57124641
(7,8-diacetyloxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-4-yl) acetate (PubChem CID 57124641) has the molecular formula C16H22O8 and a molecular weight of 342.34 g/mol. Its IUPAC name is (7,8-diacetyloxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-4-yl) acetate.
| Compound Name | (7,8-diacetyloxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-4-yl) acetate |
|---|---|
| PubChem CID | 57124641 |
| Molecular Formula | C16H22O8 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | (7,8-diacetyloxy-2-methyl-10-oxo-2,3,4,7,8,9-hexahydrooxecin-4-yl) acetate |
| SMILES | CC(=O)OC1C=CC(OC(C)=O)C(OC(C)=O)CC(=O)OC(C)C1 |
| InChI | InChI=1S/C16H22O8/c1-9-7-13(22-10(2)17)5-6-14(23-11(3)18)15(24-12(4)19)8-16(20)21-9/h5-6,9,13-15H,7-8H2,1-4H3 |
| InChIKey | NMFHCBJHTUULQA-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|