About 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine
3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine (PubChem CID 57125286) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine.
Molecular Properties
| Compound Name | 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine |
| PubChem CID | 57125286 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCCN |
| InChI | InChI=1S/C13H27NO/c1-10(2)12-6-5-11(3)9-13(12)15-8-4-7-14/h10-13H,4-9,14H2,1-3H3/t11-,12+,13-/m1/s1 |
| InChIKey | REQATEWASAXCJK-FRRDWIJNSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine?
The IUPAC name of 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine (CID 57125286) is 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine.
What is the SMILES notation for 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine?
The canonical SMILES for 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine is CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OCCCN.
What is the InChIKey of 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine?
The InChIKey is REQATEWASAXCJK-FRRDWIJNSA-N. The full InChI is InChI=1S/C13H27NO/c1-10(2)12-6-5-11(3)9-13(12)15-8-4-7-14/h10-13H,4-9,14H2,1-3H3/t11-,12+,13-/m1/s1.
What are the key properties of 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine?
3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine has a molecular weight of 213.36 g/mol, XLogP of 2.81, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxypropan-1-amine is sourced from PubChem (CID 57125286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).