C18H32N2O2 — CID 57125465
4-methyl-2-[2-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)decan-2-yl]-4,5-dihydro-1,3-oxazole (PubChem CID 57125465) has the molecular formula C18H32N2O2 and a molecular weight of 308.47 g/mol. Its IUPAC name is 4-methyl-2-[2-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)decan-2-yl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-methyl-2-[2-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)decan-2-yl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 57125465 |
| Molecular Formula | C18H32N2O2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | 4-methyl-2-[2-(4-methyl-4,5-dihydro-1,3-oxazol-2-yl)decan-2-yl]-4,5-dihydro-1,3-oxazole |
| SMILES | CCCCCCCCC(C)(C1=NC(C)CO1)C1=NC(C)CO1 |
| InChI | InChI=1S/C18H32N2O2/c1-5-6-7-8-9-10-11-18(4,16-19-14(2)12-21-16)17-20-15(3)13-22-17/h14-15H,5-13H2,1-4H3 |
| InChIKey | DLZBGOGBXKMCQK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|