C29H48O4Si — CID 57125516
(1S)-3-[(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-1-(1-adamantyl)prop-2-en-1-ol (PubChem CID 57125516) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is (1S)-3-[(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-1-(1-adamantyl)prop-2-en-1-ol.
| Compound Name | (1S)-3-[(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-1-(1-adamantyl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 57125516 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | (1S)-3-[(1'R,2'R,3'aS,6'aR)-2'-[tert-butyl(dimethyl)silyl]oxyspiro[1,3-dioxolane-2,5'-2,3,3a,4,6,6a-hexahydro-1H-pentalene]-1'-yl]-1-(1-adamantyl)prop-2-en-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1C[C@H]2CC3(C[C@H]2[C@H]1C=C[C@H](O)C12CC4CC(CC(C4)C1)C2)OCCO3 |
| InChI | InChI=1S/C29H48O4Si/c1-27(2,3)34(4,5)33-25-13-22-17-29(31-8-9-32-29)18-24(22)23(25)6-7-26(30)28-14-19-10-20(15-28)12-21(11-19)16-28/h6-7,19-26,30H,8-18H2,1-5H3/t19?,20?,21?,22-,23+,24+,25+,26-,28?/m0/s1 |
| InChIKey | NJHSGWVMHVPVGJ-LSHWBUBESA-N |
| XLogP | 6.30 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|