C12H21Cl4NO — CID 57125876
N-tert-butyl-4,6,6,6-tetrachloro-3,3-dimethylhexanamide (PubChem CID 57125876) has the molecular formula C12H21Cl4NO and a molecular weight of 337.12 g/mol. Its IUPAC name is N-tert-butyl-4,6,6,6-tetrachloro-3,3-dimethylhexanamide.
| Compound Name | N-tert-butyl-4,6,6,6-tetrachloro-3,3-dimethylhexanamide |
|---|---|
| PubChem CID | 57125876 |
| Molecular Formula | C12H21Cl4NO |
| Molecular Weight | 337.12 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-tert-butyl-4,6,6,6-tetrachloro-3,3-dimethylhexanamide |
| SMILES | CC(C)(C)NC(=O)CC(C)(C)C(Cl)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H21Cl4NO/c1-10(2,3)17-9(18)7-11(4,5)8(13)6-12(14,15)16/h8H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | PMFJDRRVOJXNBI-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.12 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|