C37H72N8 — CID 57125933
2-N,4-N,6-N,6-N-tetrabutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 57125933) has the molecular formula C37H72N8 and a molecular weight of 629.04 g/mol. Its IUPAC name is 2-N,4-N,6-N,6-N-tetrabutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,4-N,6-N,6-N-tetrabutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 57125933 |
| Molecular Formula | C37H72N8 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.59 |
| IUPAC Name | 2-N,4-N,6-N,6-N-tetrabutyl-2-N,4-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCN(CCCC)c1nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)nc(N(CCCC)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C37H72N8/c1-13-17-21-43(22-18-14-2)31-38-32(44(23-19-15-3)29-25-34(5,6)41-35(7,8)26-29)40-33(39-31)45(24-20-16-4)30-27-36(9,10)42-37(11,12)28-30/h29-30,41-42H,13-28H2,1-12H3 |
| InChIKey | GDOLUCLNBDMOCL-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 72.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |