C27H51O5P — CID 57125944
1-[trihydroxy-[2-(2,4,6-tritert-butylphenyl)hexan-2-yl]-λ5-phosphanyl]propane-1,3-diol (PubChem CID 57125944) has the molecular formula C27H51O5P and a molecular weight of 486.67 g/mol. Its IUPAC name is 1-[trihydroxy-[2-(2,4,6-tritert-butylphenyl)hexan-2-yl]-λ5-phosphanyl]propane-1,3-diol.
| Compound Name | 1-[trihydroxy-[2-(2,4,6-tritert-butylphenyl)hexan-2-yl]-λ5-phosphanyl]propane-1,3-diol |
|---|---|
| PubChem CID | 57125944 |
| Molecular Formula | C27H51O5P |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.35 |
| IUPAC Name | 1-[trihydroxy-[2-(2,4,6-tritert-butylphenyl)hexan-2-yl]-λ5-phosphanyl]propane-1,3-diol |
| SMILES | CCCCC(C)(c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)P(O)(O)(O)C(O)CCO |
| InChI | InChI=1S/C27H51O5P/c1-12-13-15-27(11,33(30,31,32)22(29)14-16-28)23-20(25(5,6)7)17-19(24(2,3)4)18-21(23)26(8,9)10/h17-18,22,28-32H,12-16H2,1-11H3 |
| InChIKey | ZZSDKUNLIDXTQC-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|