C17H24N2O — CID 57126208
N-[(1R,9bS)-1-methyl-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl]formamide (PubChem CID 57126208) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is N-[(1R,9bS)-1-methyl-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl]formamide.
| Compound Name | N-[(1R,9bS)-1-methyl-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl]formamide |
|---|---|
| PubChem CID | 57126208 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | N-[(1R,9bS)-1-methyl-3-propyl-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-9-yl]formamide |
| SMILES | CCCN1C[C@H](C)[C@H]2c3c(cccc3NC=O)CCC21 |
| InChI | InChI=1S/C17H24N2O/c1-3-9-19-10-12(2)16-15(19)8-7-13-5-4-6-14(17(13)16)18-11-20/h4-6,11-12,15-16H,3,7-10H2,1-2H3,(H,18,20)/t12-,15?,16+/m0/s1 |
| InChIKey | YNVHVBWSXILXQA-ZDKIRESNSA-N |
| XLogP | 3.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|