About [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol
[3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol (PubChem CID 57126320) has the molecular formula C5H11N2O2+
and a molecular weight of 131.16 g/mol. Its IUPAC name is [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol.
Molecular Properties
| Compound Name | [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol |
| PubChem CID | 57126320 |
| Molecular Formula | C5H11N2O2+ |
| Molecular Weight | 131.16 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol |
| SMILES | OCN1C=[N+](CO)CC1 |
| InChI | InChI=1S/C5H11N2O2/c8-4-6-1-2-7(3-6)5-9/h3,8-9H,1-2,4-5H2/q+1 |
| InChIKey | MUXBYYQLYJPZPH-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 46.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.16 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol?
The IUPAC name of [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol (CID 57126320) is [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol.
What is the SMILES notation for [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol?
The canonical SMILES for [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol is OCN1C=[N+](CO)CC1.
What is the InChIKey of [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol?
The InChIKey is MUXBYYQLYJPZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N2O2/c8-4-6-1-2-7(3-6)5-9/h3,8-9H,1-2,4-5H2/q+1.
What are the key properties of [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol?
[3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol has a molecular weight of 131.16 g/mol, XLogP of -1.76, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(hydroxymethyl)-4,5-dihydroimidazol-3-ium-1-yl]methanol is sourced from PubChem (CID 57126320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).