C31H52O4Si — CID 57126443
[(7R,8R,9S,10R,13S,14S,17S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 57126443) has the molecular formula C31H52O4Si and a molecular weight of 516.84 g/mol. Its IUPAC name is [(7R,8R,9S,10R,13S,14S,17S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(7R,8R,9S,10R,13S,14S,17S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 57126443 |
| Molecular Formula | C31H52O4Si |
| Molecular Weight | 516.84 g/mol |
| Exact Mass | 516.36 |
| IUPAC Name | [(7R,8R,9S,10R,13S,14S,17S)-7-[5-[tert-butyl(dimethyl)silyl]oxypentyl]-13-methyl-3-oxo-2,6,7,8,9,10,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@H]2[C@@H]3[C@H](CCCCCO[Si](C)(C)C(C)(C)C)CC4=CC(=O)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C31H52O4Si/c1-21(32)35-28-15-14-27-29-22(11-9-8-10-18-34-36(6,7)30(2,3)4)19-23-20-24(33)12-13-25(23)26(29)16-17-31(27,28)5/h20,22,25-29H,8-19H2,1-7H3/t22-,25+,26-,27+,28+,29-,31+/m1/s1 |
| InChIKey | MPVFFDPHZRAVIB-KNWYFYQDSA-N |
| XLogP | 7.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.84 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|