C23H29NOS — CID 57126800
2,5-dimethyl-4-pentoxy-7-(2,4,6-trimethylphenyl)thieno[3,4-b]pyridine (PubChem CID 57126800) has the molecular formula C23H29NOS and a molecular weight of 367.56 g/mol. Its IUPAC name is 2,5-dimethyl-4-pentoxy-7-(2,4,6-trimethylphenyl)thieno[3,4-b]pyridine.
| Compound Name | 2,5-dimethyl-4-pentoxy-7-(2,4,6-trimethylphenyl)thieno[3,4-b]pyridine |
|---|---|
| PubChem CID | 57126800 |
| Molecular Formula | C23H29NOS |
| Molecular Weight | 367.56 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 2,5-dimethyl-4-pentoxy-7-(2,4,6-trimethylphenyl)thieno[3,4-b]pyridine |
| SMILES | CCCCCOc1cc(C)nc2c(-c3c(C)cc(C)cc3C)sc(C)c12 |
| InChI | InChI=1S/C23H29NOS/c1-7-8-9-10-25-19-13-17(5)24-22-21(19)18(6)26-23(22)20-15(3)11-14(2)12-16(20)4/h11-13H,7-10H2,1-6H3 |
| InChIKey | SUOVVOXBFSDZAD-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.56 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|