C17H16BrN5O2 — CID 57126914
5-bromo-3-[(6-morpholin-4-yl-3-pyridinyl)iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one (PubChem CID 57126914) has the molecular formula C17H16BrN5O2 and a molecular weight of 402.25 g/mol. Its IUPAC name is 5-bromo-3-[(6-morpholin-4-yl-3-pyridinyl)iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one.
| Compound Name | 5-bromo-3-[(6-morpholin-4-yl-3-pyridinyl)iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 57126914 |
| Molecular Formula | C17H16BrN5O2 |
| Molecular Weight | 402.25 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | 5-bromo-3-[(6-morpholin-4-yl-3-pyridinyl)iminomethyl]-1,3-dihydropyrrolo[2,3-b]pyridin-2-one |
| SMILES | O=C1Nc2ncc(Br)cc2C1/C=N/c1ccc(N2CCOCC2)nc1 |
| InChI | InChI=1S/C17H16BrN5O2/c18-11-7-13-14(17(24)22-16(13)21-8-11)10-19-12-1-2-15(20-9-12)23-3-5-25-6-4-23/h1-2,7-10,14H,3-6H2,(H,21,22,24)/b19-10+ |
| InChIKey | DSULTUDCLXJZLY-VXLYETTFSA-N |
| XLogP | 2.51 |
| TPSA | 79.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.25 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|