About 2-(6,10,14-trimethylpentadecan-2-yl)oxirene
2-(6,10,14-trimethylpentadecan-2-yl)oxirene (PubChem CID 57127204) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 2-(6,10,14-trimethylpentadecan-2-yl)oxirene.
Molecular Properties
| Compound Name | 2-(6,10,14-trimethylpentadecan-2-yl)oxirene |
| PubChem CID | 57127204 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 2-(6,10,14-trimethylpentadecan-2-yl)oxirene |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)C1=CO1 |
| InChI | InChI=1S/C20H38O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)20-15-21-20/h15-19H,6-14H2,1-5H3 |
| InChIKey | GYMYTTFKBWRNHC-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(6,10,14-trimethylpentadecan-2-yl)oxirene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,10,14-trimethylpentadecan-2-yl)oxirene?
The IUPAC name of 2-(6,10,14-trimethylpentadecan-2-yl)oxirene (CID 57127204) is 2-(6,10,14-trimethylpentadecan-2-yl)oxirene.
What is the SMILES notation for 2-(6,10,14-trimethylpentadecan-2-yl)oxirene?
The canonical SMILES for 2-(6,10,14-trimethylpentadecan-2-yl)oxirene is CC(C)CCCC(C)CCCC(C)CCCC(C)C1=CO1.
What is the InChIKey of 2-(6,10,14-trimethylpentadecan-2-yl)oxirene?
The InChIKey is GYMYTTFKBWRNHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O/c1-16(2)9-6-10-17(3)11-7-12-18(4)13-8-14-19(5)20-15-21-20/h15-19H,6-14H2,1-5H3.
What are the key properties of 2-(6,10,14-trimethylpentadecan-2-yl)oxirene?
2-(6,10,14-trimethylpentadecan-2-yl)oxirene has a molecular weight of 294.52 g/mol, XLogP of 6.93, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,10,14-trimethylpentadecan-2-yl)oxirene is sourced from PubChem (CID 57127204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).