About 5,7-dimethyl-8H-1,6-naphthyridin-2-one
5,7-dimethyl-8H-1,6-naphthyridin-2-one (PubChem CID 57127816) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 5,7-dimethyl-8H-1,6-naphthyridin-2-one.
Molecular Properties
| Compound Name | 5,7-dimethyl-8H-1,6-naphthyridin-2-one |
| PubChem CID | 57127816 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 5,7-dimethyl-8H-1,6-naphthyridin-2-one |
| SMILES | CC1=NC(C)=C2C=CC(=O)N=C2C1 |
| InChI | InChI=1S/C10H10N2O/c1-6-5-9-8(7(2)11-6)3-4-10(13)12-9/h3-4H,5H2,1-2H3 |
| InChIKey | KZONYOGEZARQFG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,7-dimethyl-8H-1,6-naphthyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethyl-8H-1,6-naphthyridin-2-one?
The IUPAC name of 5,7-dimethyl-8H-1,6-naphthyridin-2-one (CID 57127816) is 5,7-dimethyl-8H-1,6-naphthyridin-2-one.
What is the SMILES notation for 5,7-dimethyl-8H-1,6-naphthyridin-2-one?
The canonical SMILES for 5,7-dimethyl-8H-1,6-naphthyridin-2-one is CC1=NC(C)=C2C=CC(=O)N=C2C1.
What is the InChIKey of 5,7-dimethyl-8H-1,6-naphthyridin-2-one?
The InChIKey is KZONYOGEZARQFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-6-5-9-8(7(2)11-6)3-4-10(13)12-9/h3-4H,5H2,1-2H3.
What are the key properties of 5,7-dimethyl-8H-1,6-naphthyridin-2-one?
5,7-dimethyl-8H-1,6-naphthyridin-2-one has a molecular weight of 174.20 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethyl-8H-1,6-naphthyridin-2-one is sourced from PubChem (CID 57127816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).