C22H24O5 — CID 57127886
(10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13,16-trimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione (PubChem CID 57127886) has the molecular formula C22H24O5 and a molecular weight of 368.43 g/mol. Its IUPAC name is (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13,16-trimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione.
| Compound Name | (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13,16-trimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione |
|---|---|
| PubChem CID | 57127886 |
| Molecular Formula | C22H24O5 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | (10S,13S,14R,17S)-17-(2-hydroxyacetyl)-10,13,16-trimethyl-14,15,16,17-tetrahydro-12H-cyclopenta[a]phenanthrene-1,3,11-trione |
| SMILES | CC1C[C@H]2C3=C(C(=O)C[C@]2(C)[C@H]1C(=O)CO)[C@@]1(C)C(=O)CC(=O)C=C1C=C3 |
| InChI | InChI=1S/C22H24O5/c1-11-6-15-14-5-4-12-7-13(24)8-18(27)22(12,3)20(14)16(25)9-21(15,2)19(11)17(26)10-23/h4-5,7,11,15,19,23H,6,8-10H2,1-3H3/t11?,15-,19+,21-,22+/m0/s1 |
| InChIKey | SNQUICLAQVWOGI-BAWMGAJWSA-N |
| XLogP | 2.14 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|