C9H16O4 — CID 57128049
(3S,4R,5S,6R)-5-ethyl-4,6-dihydroxy-3-methyloxepan-2-one (PubChem CID 57128049) has the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. Its IUPAC name is (3S,4R,5S,6R)-5-ethyl-4,6-dihydroxy-3-methyloxepan-2-one.
| Compound Name | (3S,4R,5S,6R)-5-ethyl-4,6-dihydroxy-3-methyloxepan-2-one |
|---|---|
| PubChem CID | 57128049 |
| Molecular Formula | C9H16O4 |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | (3S,4R,5S,6R)-5-ethyl-4,6-dihydroxy-3-methyloxepan-2-one |
| SMILES | CC[C@H]1[C@@H](O)[C@H](C)C(=O)OC[C@@H]1O |
| InChI | InChI=1S/C9H16O4/c1-3-6-7(10)4-13-9(12)5(2)8(6)11/h5-8,10-11H,3-4H2,1-2H3/t5-,6+,7-,8-/m0/s1 |
| InChIKey | BKWILXYSPRMOLN-YWIQKCBGSA-N |
| XLogP | -0.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |