C6H9F3O — CID 57128345
1,1,3-trifluoro-2-prop-2-enoxypropane (PubChem CID 57128345) has the molecular formula C6H9F3O and a molecular weight of 154.13 g/mol. Its IUPAC name is 1,1,3-trifluoro-2-prop-2-enoxypropane.
| Compound Name | 1,1,3-trifluoro-2-prop-2-enoxypropane |
|---|---|
| PubChem CID | 57128345 |
| Molecular Formula | C6H9F3O |
| Molecular Weight | 154.13 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1,1,3-trifluoro-2-prop-2-enoxypropane |
| SMILES | C=CCOC(CF)C(F)F |
| InChI | InChI=1S/C6H9F3O/c1-2-3-10-5(4-7)6(8)9/h2,5-6H,1,3-4H2 |
| InChIKey | SGONEJMHLAFZHM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.13 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|