C16H24N10S4 — CID 57128999
2-[4-[2-[[4-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1,2,5-thiadiazol-3-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine (PubChem CID 57128999) has the molecular formula C16H24N10S4 and a molecular weight of 484.71 g/mol. Its IUPAC name is 2-[4-[2-[[4-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1,2,5-thiadiazol-3-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-[[4-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1,2,5-thiadiazol-3-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 57128999 |
| Molecular Formula | C16H24N10S4 |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | 2-[4-[2-[[4-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethylamino]-1,2,5-thiadiazol-3-yl]amino]ethylsulfanylmethyl]-1,3-thiazol-2-yl]guanidine |
| SMILES | Cc1[nH]cnc1CSCCNc1nsnc1NCCSCc1csc(N=C(N)N)n1 |
| InChI | InChI=1S/C16H24N10S4/c1-10-12(22-9-21-10)8-28-5-3-20-14-13(25-30-26-14)19-2-4-27-6-11-7-29-16(23-11)24-15(17)18/h7,9H,2-6,8H2,1H3,(H,19,25)(H,20,26)(H,21,22)(H4,17,18,23,24) |
| InChIKey | USFVHGLOSVAIPC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 155.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|