C18H17F2N5 — CID 57129018
7-(2,5-difluorophenyl)-5-(4-methylphenyl)-4,6-dihydro-1H-pyrazolo[5,4-d]pyrimidin-4-amine (PubChem CID 57129018) has the molecular formula C18H17F2N5 and a molecular weight of 341.37 g/mol. Its IUPAC name is 7-(2,5-difluorophenyl)-5-(4-methylphenyl)-4,6-dihydro-1H-pyrazolo[5,4-d]pyrimidin-4-amine.
| Compound Name | 7-(2,5-difluorophenyl)-5-(4-methylphenyl)-4,6-dihydro-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 57129018 |
| Molecular Formula | C18H17F2N5 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 7-(2,5-difluorophenyl)-5-(4-methylphenyl)-4,6-dihydro-1H-pyrazolo[5,4-d]pyrimidin-4-amine |
| SMILES | Cc1ccc(N2CN(c3cc(F)ccc3F)c3[nH]ncc3C2N)cc1 |
| InChI | InChI=1S/C18H17F2N5/c1-11-2-5-13(6-3-11)24-10-25(16-8-12(19)4-7-15(16)20)18-14(17(24)21)9-22-23-18/h2-9,17H,10,21H2,1H3,(H,22,23) |
| InChIKey | JRLWCNUTIGGQOR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 61.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|