C24H50O5Si — CID 57129125
[(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate (PubChem CID 57129125) has the molecular formula C24H50O5Si and a molecular weight of 446.75 g/mol. Its IUPAC name is [(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate.
| Compound Name | [(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 57129125 |
| Molecular Formula | C24H50O5Si |
| Molecular Weight | 446.75 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | [(2R,4S,5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethoxy-2,8-dimethylnonyl] 2,2-dimethylpropanoate |
| SMILES | CO[C@@H](CC(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C[C@@H](C)COC(=O)C(C)(C)C)OC |
| InChI | InChI=1S/C24H50O5Si/c1-17(2)14-19(26-10)21(29-30(12,13)24(7,8)9)20(27-11)15-18(3)16-28-22(25)23(4,5)6/h17-21H,14-16H2,1-13H3/t18-,19+,20+,21-/m1/s1 |
| InChIKey | VPBLJLQPWQDVNK-IVAOSVALSA-N |
| XLogP | 6.07 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.75 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|