C28H28ClNO3 — CID 57129383
2-[4-(2-chlorophenyl)phenyl]-5-oxo-5-(4-phenylpiperidin-1-yl)pentanoic acid (PubChem CID 57129383) has the molecular formula C28H28ClNO3 and a molecular weight of 461.99 g/mol. Its IUPAC name is 2-[4-(2-chlorophenyl)phenyl]-5-oxo-5-(4-phenylpiperidin-1-yl)pentanoic acid.
| Compound Name | 2-[4-(2-chlorophenyl)phenyl]-5-oxo-5-(4-phenylpiperidin-1-yl)pentanoic acid |
|---|---|
| PubChem CID | 57129383 |
| Molecular Formula | C28H28ClNO3 |
| Molecular Weight | 461.99 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[4-(2-chlorophenyl)phenyl]-5-oxo-5-(4-phenylpiperidin-1-yl)pentanoic acid |
| SMILES | O=C(O)C(CCC(=O)N1CCC(c2ccccc2)CC1)c1ccc(-c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C28H28ClNO3/c29-26-9-5-4-8-24(26)22-10-12-23(13-11-22)25(28(32)33)14-15-27(31)30-18-16-21(17-19-30)20-6-2-1-3-7-20/h1-13,21,25H,14-19H2,(H,32,33) |
| InChIKey | BJVXHGYAANFDBN-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.99 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |