C35H56O6SSi — CID 57129811
methyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-(7-phenylhept-1-enyl)cyclopenten-1-yl]sulfanyl-2-hydroxyhexanoate (PubChem CID 57129811) has the molecular formula C35H56O6SSi and a molecular weight of 632.98 g/mol. Its IUPAC name is methyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-(7-phenylhept-1-enyl)cyclopenten-1-yl]sulfanyl-2-hydroxyhexanoate.
| Compound Name | methyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-(7-phenylhept-1-enyl)cyclopenten-1-yl]sulfanyl-2-hydroxyhexanoate |
|---|---|
| PubChem CID | 57129811 |
| Molecular Formula | C35H56O6SSi |
| Molecular Weight | 632.98 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | methyl 6-[(4R,5S)-2-butanoyloxy-4-[tert-butyl(dimethyl)silyl]oxy-5-(7-phenylhept-1-enyl)cyclopenten-1-yl]sulfanyl-2-hydroxyhexanoate |
| SMILES | CCCC(=O)OC1=C(SCCCCC(O)C(=O)OC)[C@@H](C=CCCCCCc2ccccc2)[C@H](O[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C35H56O6SSi/c1-8-19-32(37)40-31-26-30(41-43(6,7)35(2,3)4)28(33(31)42-25-18-17-24-29(36)34(38)39-5)23-16-11-9-10-13-20-27-21-14-12-15-22-27/h12,14-16,21-23,28-30,36H,8-11,13,17-20,24-26H2,1-7H3/t28-,29?,30+/m0/s1 |
| InChIKey | FEFVCQQAHADADB-YFISABEZSA-N |
| XLogP | 8.75 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.98 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|