About CID 57129895
CID 57129895 (PubChem CID 57129895) has the molecular formula C5H7N4+
and a molecular weight of 123.14 g/mol.
Molecular Properties
| Compound Name | CID 57129895 |
| PubChem CID | 57129895 |
| Molecular Formula | C5H7N4+ |
| Molecular Weight | 123.14 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | — |
| SMILES | CN1CN(CC#N)[C+]=N1 |
| InChI | InChI=1S/C5H7N4/c1-8-5-9(3-2-6)4-7-8/h3,5H2,1H3/q+1 |
| InChIKey | QJBHHVUAVMHLHP-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 42.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.14 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze CID 57129895 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 57129895?
The IUPAC name of CID 57129895 (CID 57129895) is not available.
What is the SMILES notation for CID 57129895?
The canonical SMILES for CID 57129895 is CN1CN(CC#N)[C+]=N1.
What is the InChIKey of CID 57129895?
The InChIKey is QJBHHVUAVMHLHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N4/c1-8-5-9(3-2-6)4-7-8/h3,5H2,1H3/q+1.
What are the key properties of CID 57129895?
CID 57129895 has a molecular weight of 123.14 g/mol, XLogP of -0.46, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 57129895 is sourced from PubChem (CID 57129895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).