C14H22O — CID 57129952
4-(2,2,3,6-tetramethylcyclohex-3-en-1-yl)but-3-en-2-one (PubChem CID 57129952) has the molecular formula C14H22O and a molecular weight of 206.33 g/mol. Its IUPAC name is 4-(2,2,3,6-tetramethylcyclohex-3-en-1-yl)but-3-en-2-one.
| Compound Name | 4-(2,2,3,6-tetramethylcyclohex-3-en-1-yl)but-3-en-2-one |
|---|---|
| PubChem CID | 57129952 |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.17 |
| IUPAC Name | 4-(2,2,3,6-tetramethylcyclohex-3-en-1-yl)but-3-en-2-one |
| SMILES | CC(=O)C=CC1C(C)CC=C(C)C1(C)C |
| InChI | InChI=1S/C14H22O/c1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15/h7-10,13H,6H2,1-5H3 |
| InChIKey | MABGGVQYWIUHTJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|