C20H25NO4 — CID 57130165
(1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylate (PubChem CID 57130165) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylate.
| Compound Name | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 57130165 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl 2,2-dimethyl-3-(2-methylbuta-1,3-dienyl)cyclopropane-1-carboxylate |
| SMILES | C=CC(C)=CC1C(C(=O)OCN2C(=O)C3=C(CCCC3)C2=O)C1(C)C |
| InChI | InChI=1S/C20H25NO4/c1-5-12(2)10-15-16(20(15,3)4)19(24)25-11-21-17(22)13-8-6-7-9-14(13)18(21)23/h5,10,15-16H,1,6-9,11H2,2-4H3 |
| InChIKey | AUSQSGKNAYJLKO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|