C18H30N2 — CID 57130714
3-[6-(4-methylpiperidin-1-yl)hexan-3-yl]aniline (PubChem CID 57130714) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 3-[6-(4-methylpiperidin-1-yl)hexan-3-yl]aniline.
| Compound Name | 3-[6-(4-methylpiperidin-1-yl)hexan-3-yl]aniline |
|---|---|
| PubChem CID | 57130714 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 3-[6-(4-methylpiperidin-1-yl)hexan-3-yl]aniline |
| SMILES | CCC(CCCN1CCC(C)CC1)c1cccc(N)c1 |
| InChI | InChI=1S/C18H30N2/c1-3-16(17-6-4-8-18(19)14-17)7-5-11-20-12-9-15(2)10-13-20/h4,6,8,14-16H,3,5,7,9-13,19H2,1-2H3 |
| InChIKey | YOPCKBPHCAVSQI-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|