About 3-azabicyclo[4.2.0]octa-1,3,7-triene
3-azabicyclo[4.2.0]octa-1,3,7-triene (PubChem CID 57130799) has the molecular formula C7H7N
and a molecular weight of 105.14 g/mol. Its IUPAC name is 3-azabicyclo[4.2.0]octa-1,3,7-triene.
Molecular Properties
| Compound Name | 3-azabicyclo[4.2.0]octa-1,3,7-triene |
| PubChem CID | 57130799 |
| Molecular Formula | C7H7N |
| Molecular Weight | 105.14 g/mol |
| Exact Mass | 105.06 |
| IUPAC Name | 3-azabicyclo[4.2.0]octa-1,3,7-triene |
| SMILES | C1=CC2CC=NC=C12 |
| InChI | InChI=1S/C7H7N/c1-2-7-5-8-4-3-6(1)7/h1-2,4-6H,3H2 |
| InChIKey | CVJPXOBDWQEYPS-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.14 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-azabicyclo[4.2.0]octa-1,3,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azabicyclo[4.2.0]octa-1,3,7-triene?
The IUPAC name of 3-azabicyclo[4.2.0]octa-1,3,7-triene (CID 57130799) is 3-azabicyclo[4.2.0]octa-1,3,7-triene.
What is the SMILES notation for 3-azabicyclo[4.2.0]octa-1,3,7-triene?
The canonical SMILES for 3-azabicyclo[4.2.0]octa-1,3,7-triene is C1=CC2CC=NC=C12.
What is the InChIKey of 3-azabicyclo[4.2.0]octa-1,3,7-triene?
The InChIKey is CVJPXOBDWQEYPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N/c1-2-7-5-8-4-3-6(1)7/h1-2,4-6H,3H2.
What are the key properties of 3-azabicyclo[4.2.0]octa-1,3,7-triene?
3-azabicyclo[4.2.0]octa-1,3,7-triene has a molecular weight of 105.14 g/mol, XLogP of 1.53, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azabicyclo[4.2.0]octa-1,3,7-triene is sourced from PubChem (CID 57130799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).