About 1H-imidazol-2-yl 2-hydroxybenzoate
1H-imidazol-2-yl 2-hydroxybenzoate (PubChem CID 57130822) has the molecular formula C10H8N2O3
and a molecular weight of 204.19 g/mol. Its IUPAC name is 1H-imidazol-2-yl 2-hydroxybenzoate.
Molecular Properties
| Compound Name | 1H-imidazol-2-yl 2-hydroxybenzoate |
| PubChem CID | 57130822 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1H-imidazol-2-yl 2-hydroxybenzoate |
| SMILES | O=C(Oc1ncc[nH]1)c1ccccc1O |
| InChI | InChI=1S/C10H8N2O3/c13-8-4-2-1-3-7(8)9(14)15-10-11-5-6-12-10/h1-6,13H,(H,11,12) |
| InChIKey | AHRHFTHKINYPFL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1H-imidazol-2-yl 2-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazol-2-yl 2-hydroxybenzoate?
The IUPAC name of 1H-imidazol-2-yl 2-hydroxybenzoate (CID 57130822) is 1H-imidazol-2-yl 2-hydroxybenzoate.
What is the SMILES notation for 1H-imidazol-2-yl 2-hydroxybenzoate?
The canonical SMILES for 1H-imidazol-2-yl 2-hydroxybenzoate is O=C(Oc1ncc[nH]1)c1ccccc1O.
What is the InChIKey of 1H-imidazol-2-yl 2-hydroxybenzoate?
The InChIKey is AHRHFTHKINYPFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2O3/c13-8-4-2-1-3-7(8)9(14)15-10-11-5-6-12-10/h1-6,13H,(H,11,12).
What are the key properties of 1H-imidazol-2-yl 2-hydroxybenzoate?
1H-imidazol-2-yl 2-hydroxybenzoate has a molecular weight of 204.19 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazol-2-yl 2-hydroxybenzoate is sourced from PubChem (CID 57130822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).