C19H19N4O3P — CID 57130935
[4-(2,4,6-trimethylanilino)imidazo[1,5-a]quinoxalin-1-yl]phosphonic acid (PubChem CID 57130935) has the molecular formula C19H19N4O3P and a molecular weight of 382.36 g/mol. Its IUPAC name is [4-(2,4,6-trimethylanilino)imidazo[1,5-a]quinoxalin-1-yl]phosphonic acid.
| Compound Name | [4-(2,4,6-trimethylanilino)imidazo[1,5-a]quinoxalin-1-yl]phosphonic acid |
|---|---|
| PubChem CID | 57130935 |
| Molecular Formula | C19H19N4O3P |
| Molecular Weight | 382.36 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | [4-(2,4,6-trimethylanilino)imidazo[1,5-a]quinoxalin-1-yl]phosphonic acid |
| SMILES | Cc1cc(C)c(Nc2nc3ccccc3n3c(P(=O)(O)O)ncc23)c(C)c1 |
| InChI | InChI=1S/C19H19N4O3P/c1-11-8-12(2)17(13(3)9-11)22-18-16-10-20-19(27(24,25)26)23(16)15-7-5-4-6-14(15)21-18/h4-10H,1-3H3,(H,21,22)(H2,24,25,26) |
| InChIKey | PJZHFWVNDRBVEH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 99.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|