About 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine
2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine (PubChem CID 57131236) has the molecular formula C8H16N4O2
and a molecular weight of 200.24 g/mol. Its IUPAC name is 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine.
Molecular Properties
| Compound Name | 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine |
| PubChem CID | 57131236 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine |
| SMILES | CC(=O)C(=O)[C@@H](N)CCCN=C(N)N |
| InChI | InChI=1S/C8H16N4O2/c1-5(13)7(14)6(9)3-2-4-12-8(10)11/h6H,2-4,9H2,1H3,(H4,10,11,12)/t6-/m0/s1 |
| InChIKey | WZHGGIZZGPORDM-LURJTMIESA-N |
| XLogP | -1.47 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine?
The IUPAC name of 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine (CID 57131236) is 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine.
What is the SMILES notation for 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine?
The canonical SMILES for 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine is CC(=O)C(=O)[C@@H](N)CCCN=C(N)N.
What is the InChIKey of 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine?
The InChIKey is WZHGGIZZGPORDM-LURJTMIESA-N. The full InChI is InChI=1S/C8H16N4O2/c1-5(13)7(14)6(9)3-2-4-12-8(10)11/h6H,2-4,9H2,1H3,(H4,10,11,12)/t6-/m0/s1.
What are the key properties of 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine?
2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine has a molecular weight of 200.24 g/mol, XLogP of -1.47, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-4-amino-5,6-dioxoheptyl]guanidine is sourced from PubChem (CID 57131236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).