C7H12N2 — CID 57131723
3,5-dimethyl-4,7-dihydro-3H-diazepine (PubChem CID 57131723) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 3,5-dimethyl-4,7-dihydro-3H-diazepine.
| Compound Name | 3,5-dimethyl-4,7-dihydro-3H-diazepine |
|---|---|
| PubChem CID | 57131723 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3,5-dimethyl-4,7-dihydro-3H-diazepine |
| SMILES | CC1=CCN=NC(C)C1 |
| InChI | InChI=1S/C7H12N2/c1-6-3-4-8-9-7(2)5-6/h3,7H,4-5H2,1-2H3 |
| InChIKey | BDAIRSNJQRUVCW-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|