C35H49NO3Si — CID 57131986
N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylmethoxypentan-2-yl]heptanamide (PubChem CID 57131986) has the molecular formula C35H49NO3Si and a molecular weight of 559.87 g/mol. Its IUPAC name is N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylmethoxypentan-2-yl]heptanamide.
| Compound Name | N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylmethoxypentan-2-yl]heptanamide |
|---|---|
| PubChem CID | 57131986 |
| Molecular Formula | C35H49NO3Si |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | N-[(2S,3R)-1-[tert-butyl(diphenyl)silyl]oxy-3-phenylmethoxypentan-2-yl]heptanamide |
| SMILES | CCCCCCC(=O)N[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](CC)OCc1ccccc1 |
| InChI | InChI=1S/C35H49NO3Si/c1-6-8-9-19-26-34(37)36-32(33(7-2)38-27-29-20-13-10-14-21-29)28-39-40(35(3,4)5,30-22-15-11-16-23-30)31-24-17-12-18-25-31/h10-18,20-25,32-33H,6-9,19,26-28H2,1-5H3,(H,36,37)/t32-,33+/m0/s1 |
| InChIKey | YVODMOHNSNNIBZ-JHOUSYSJSA-N |
| XLogP | 7.01 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|