C22H26F3NOS — CID 57132074
(3S,5S)-3-ethyl-8-methoxy-5-phenyl-3-(4,4,4-trifluorobutyl)-4,5-dihydro-2H-1,4-benzothiazepine (PubChem CID 57132074) has the molecular formula C22H26F3NOS and a molecular weight of 409.52 g/mol. Its IUPAC name is (3S,5S)-3-ethyl-8-methoxy-5-phenyl-3-(4,4,4-trifluorobutyl)-4,5-dihydro-2H-1,4-benzothiazepine.
| Compound Name | (3S,5S)-3-ethyl-8-methoxy-5-phenyl-3-(4,4,4-trifluorobutyl)-4,5-dihydro-2H-1,4-benzothiazepine |
|---|---|
| PubChem CID | 57132074 |
| Molecular Formula | C22H26F3NOS |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | (3S,5S)-3-ethyl-8-methoxy-5-phenyl-3-(4,4,4-trifluorobutyl)-4,5-dihydro-2H-1,4-benzothiazepine |
| SMILES | CC[C@]1(CCCC(F)(F)F)CSc2cc(OC)ccc2[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C22H26F3NOS/c1-3-21(12-7-13-22(23,24)25)15-28-19-14-17(27-2)10-11-18(19)20(26-21)16-8-5-4-6-9-16/h4-6,8-11,14,20,26H,3,7,12-13,15H2,1-2H3/t20-,21-/m0/s1 |
| InChIKey | KCBZJNLUYCCDAN-SFTDATJTSA-N |
| XLogP | 6.36 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |