About dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium
dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium (PubChem CID 57132511) has the molecular formula C22H24Cl2N3O+
and a molecular weight of 417.36 g/mol. Its IUPAC name is dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium.
Molecular Properties
| Compound Name | dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium |
| PubChem CID | 57132511 |
| Molecular Formula | C22H24Cl2N3O+ |
| Molecular Weight | 417.36 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium |
| SMILES | COc1ccc(C[N+](Cc2ccccc2)(Cc2ccccc2)NN)c(Cl)c1Cl |
| InChI | InChI=1S/C22H24Cl2N3O/c1-28-20-13-12-19(21(23)22(20)24)16-27(26-25,14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18/h2-13,26H,14-16,25H2,1H3/q+1 |
| InChIKey | JTMVWCHUENLVKG-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 417.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium?
The IUPAC name of dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium (CID 57132511) is dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium.
What is the SMILES notation for dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium?
The canonical SMILES for dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium is COc1ccc(C[N+](Cc2ccccc2)(Cc2ccccc2)NN)c(Cl)c1Cl.
What is the InChIKey of dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium?
The InChIKey is JTMVWCHUENLVKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24Cl2N3O/c1-28-20-13-12-19(21(23)22(20)24)16-27(26-25,14-17-8-4-2-5-9-17)15-18-10-6-3-7-11-18/h2-13,26H,14-16,25H2,1H3/q+1.
What are the key properties of dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium?
dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium has a molecular weight of 417.36 g/mol, XLogP of 5.10, 8 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl-[(2,3-dichloro-4-methoxyphenyl)methyl]-hydrazinylazanium is sourced from PubChem (CID 57132511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).