C11H13F3N2O — CID 57132572
3-[(2,2-difluoro-1-phenylethenyl)amino]oxy-2-fluoropropan-1-amine (PubChem CID 57132572) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-[(2,2-difluoro-1-phenylethenyl)amino]oxy-2-fluoropropan-1-amine.
| Compound Name | 3-[(2,2-difluoro-1-phenylethenyl)amino]oxy-2-fluoropropan-1-amine |
|---|---|
| PubChem CID | 57132572 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-[(2,2-difluoro-1-phenylethenyl)amino]oxy-2-fluoropropan-1-amine |
| SMILES | NCC(F)CONC(=C(F)F)c1ccccc1 |
| InChI | InChI=1S/C11H13F3N2O/c12-9(6-15)7-17-16-10(11(13)14)8-4-2-1-3-5-8/h1-5,9,16H,6-7,15H2 |
| InChIKey | IMWONQFQMWXAEE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|