About (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate
(2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 57132659) has the molecular formula C24H19F3N2O3
and a molecular weight of 440.42 g/mol. Its IUPAC name is (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate |
| PubChem CID | 57132659 |
| Molecular Formula | C24H19F3N2O3 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | NC(=O)C1c2ccc(OC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2CC1N |
| InChI | InChI=1S/C24H19F3N2O3/c25-24(26,27)15-7-5-13(6-8-15)17-3-1-2-4-19(17)23(31)32-16-9-10-18-14(11-16)12-20(28)21(18)22(29)30/h1-11,20-21H,12,28H2,(H2,29,30) |
| InChIKey | AYFNEFKRSCSZKA-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate?
The IUPAC name of (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate (CID 57132659) is (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate.
What is the SMILES notation for (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate?
The canonical SMILES for (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate is NC(=O)C1c2ccc(OC(=O)c3ccccc3-c3ccc(C(F)(F)F)cc3)cc2CC1N.
What is the InChIKey of (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate?
The InChIKey is AYFNEFKRSCSZKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F3N2O3/c25-24(26,27)15-7-5-13(6-8-15)17-3-1-2-4-19(17)23(31)32-16-9-10-18-14(11-16)12-20(28)21(18)22(29)30/h1-11,20-21H,12,28H2,(H2,29,30).
What are the key properties of (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate?
(2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate has a molecular weight of 440.42 g/mol, XLogP of 4.04, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1-carbamoyl-2,3-dihydro-1H-inden-5-yl) 2-[4-(trifluoromethyl)phenyl]benzoate is sourced from PubChem (CID 57132659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).