C40H42N4O — CID 57132947
4-[1-[4-(dimethylamino)phenyl]-2-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-6-yl)ethyl]-N,N-dimethylaniline (PubChem CID 57132947) has the molecular formula C40H42N4O and a molecular weight of 594.80 g/mol. Its IUPAC name is 4-[1-[4-(dimethylamino)phenyl]-2-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-6-yl)ethyl]-N,N-dimethylaniline.
| Compound Name | 4-[1-[4-(dimethylamino)phenyl]-2-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-6-yl)ethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 57132947 |
| Molecular Formula | C40H42N4O |
| Molecular Weight | 594.80 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 4-[1-[4-(dimethylamino)phenyl]-2-(1',3',3'-trimethylspiro[benzo[f][1,4]benzoxazine-3,2'-indole]-6-yl)ethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(Cc2cc3c(c4ccccc24)N=CC2(O3)N(C)c3ccccc3C2(C)C)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C40H42N4O/c1-39(2)35-14-10-11-15-36(35)44(7)40(39)26-41-38-33-13-9-8-12-32(33)29(25-37(38)45-40)24-34(27-16-20-30(21-17-27)42(3)4)28-18-22-31(23-19-28)43(5)6/h8-23,25-26,34H,24H2,1-7H3 |
| InChIKey | SQHWUBKAVSFFQX-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 31.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.80 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'} |
|---|