C29H48O4Si — CID 57133268
methyl 5-[(3aS,4R,6aS)-4-prop-1-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-3-oxopentanoate (PubChem CID 57133268) has the molecular formula C29H48O4Si and a molecular weight of 488.79 g/mol. Its IUPAC name is methyl 5-[(3aS,4R,6aS)-4-prop-1-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-3-oxopentanoate.
| Compound Name | methyl 5-[(3aS,4R,6aS)-4-prop-1-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-3-oxopentanoate |
|---|---|
| PubChem CID | 57133268 |
| Molecular Formula | C29H48O4Si |
| Molecular Weight | 488.79 g/mol |
| Exact Mass | 488.33 |
| IUPAC Name | methyl 5-[(3aS,4R,6aS)-4-prop-1-enyl-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-2-[tert-butyl(dimethyl)silyl]oxy-2-cyclohexyl-3-oxopentanoate |
| SMILES | CC=C[C@H]1CC[C@H]2CC(=CCC(=O)C(O[Si](C)(C)C(C)(C)C)(C(=O)OC)C3CCCCC3)C[C@@H]21 |
| InChI | InChI=1S/C29H48O4Si/c1-8-12-22-16-17-23-19-21(20-25(22)23)15-18-26(30)29(27(31)32-5,24-13-10-9-11-14-24)33-34(6,7)28(2,3)4/h8,12,15,22-25H,9-11,13-14,16-20H2,1-7H3/t22-,23-,25+,29?/m0/s1 |
| InChIKey | KDVFBBBAGYACQT-RQWQHROZSA-N |
| XLogP | 7.40 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.79 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|