C24H45F3O2Si — CID 57133878
6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-methylheptan-2-ol (PubChem CID 57133878) has the molecular formula C24H45F3O2Si and a molecular weight of 450.70 g/mol. Its IUPAC name is 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-methylheptan-2-ol.
| Compound Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 57133878 |
| Molecular Formula | C24H45F3O2Si |
| Molecular Weight | 450.70 g/mol |
| Exact Mass | 450.31 |
| IUPAC Name | 6-[(1R,3aR,4S,7aR)-4-[tert-butyl(dimethyl)silyl]oxy-7a-methyl-1,2,3,3a,4,5,6,7-octahydroinden-1-yl]-1,1,1-trifluoro-2-methylheptan-2-ol |
| SMILES | CC(CCCC(C)(O)C(F)(F)F)[C@H]1CC[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C24H45F3O2Si/c1-17(11-9-16-23(6,28)24(25,26)27)18-13-14-19-20(12-10-15-22(18,19)5)29-30(7,8)21(2,3)4/h17-20,28H,9-16H2,1-8H3/t17?,18-,19+,20+,22-,23?/m1/s1 |
| InChIKey | CAVJOTNGCJUOCW-NHJDIDGXSA-N |
| XLogP | 7.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.70 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|