C28H50O5Si — CID 57134141
[9-[(2S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate (PubChem CID 57134141) has the molecular formula C28H50O5Si and a molecular weight of 494.79 g/mol. Its IUPAC name is [9-[(2S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate.
| Compound Name | [9-[(2S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate |
|---|---|
| PubChem CID | 57134141 |
| Molecular Formula | C28H50O5Si |
| Molecular Weight | 494.79 g/mol |
| Exact Mass | 494.34 |
| IUPAC Name | [9-[(2S)-6-[2-[tert-butyl(dimethyl)silyl]oxyethylidene]-2-methyl-3-oxooxepan-2-yl]-2,6-dimethylnon-2-en-5-yl] acetate |
| SMILES | CC(=O)OC(CC=C(C)C)C(C)CCC[C@]1(C)OCC(=CCO[Si](C)(C)C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C28H50O5Si/c1-21(2)13-15-25(33-23(4)29)22(3)12-11-18-28(8)26(30)16-14-24(20-31-28)17-19-32-34(9,10)27(5,6)7/h13,17,22,25H,11-12,14-16,18-20H2,1-10H3/t22?,25?,28-/m0/s1 |
| InChIKey | QYNWMEIAFJXYKJ-XUYPSIEWSA-N |
| XLogP | 7.17 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.79 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|