About 5-methyltetrazol-5-amine
5-methyltetrazol-5-amine (PubChem CID 57134165) has the molecular formula C2H5N5
and a molecular weight of 99.10 g/mol. Its IUPAC name is 5-methyltetrazol-5-amine.
Molecular Properties
| Compound Name | 5-methyltetrazol-5-amine |
| PubChem CID | 57134165 |
| Molecular Formula | C2H5N5 |
| Molecular Weight | 99.10 g/mol |
| Exact Mass | 99.05 |
| IUPAC Name | 5-methyltetrazol-5-amine |
| SMILES | CC1(N)N=NN=N1 |
| InChI | InChI=1S/C2H5N5/c1-2(3)4-6-7-5-2/h3H2,1H3 |
| InChIKey | LNWHVBFTHRERBI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.10 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methyltetrazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyltetrazol-5-amine?
The IUPAC name of 5-methyltetrazol-5-amine (CID 57134165) is 5-methyltetrazol-5-amine.
What is the SMILES notation for 5-methyltetrazol-5-amine?
The canonical SMILES for 5-methyltetrazol-5-amine is CC1(N)N=NN=N1.
What is the InChIKey of 5-methyltetrazol-5-amine?
The InChIKey is LNWHVBFTHRERBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5N5/c1-2(3)4-6-7-5-2/h3H2,1H3.
What are the key properties of 5-methyltetrazol-5-amine?
5-methyltetrazol-5-amine has a molecular weight of 99.10 g/mol, XLogP of 0.45, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyltetrazol-5-amine is sourced from PubChem (CID 57134165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).