About 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate
2-O-(diaminomethylideneamino) 1-O-ethyl oxalate (PubChem CID 57134216) has the molecular formula C5H9N3O4
and a molecular weight of 175.14 g/mol. Its IUPAC name is 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate.
Molecular Properties
| Compound Name | 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate |
| PubChem CID | 57134216 |
| Molecular Formula | C5H9N3O4 |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate |
| SMILES | CCOC(=O)C(=O)ON=C(N)N |
| InChI | InChI=1S/C5H9N3O4/c1-2-11-3(9)4(10)12-8-5(6)7/h2H2,1H3,(H4,6,7,8) |
| InChIKey | YMPJOABWVDQHLR-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate?
The IUPAC name of 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate (CID 57134216) is 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate.
What is the SMILES notation for 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate?
The canonical SMILES for 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate is CCOC(=O)C(=O)ON=C(N)N.
What is the InChIKey of 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate?
The InChIKey is YMPJOABWVDQHLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3O4/c1-2-11-3(9)4(10)12-8-5(6)7/h2H2,1H3,(H4,6,7,8).
What are the key properties of 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate?
2-O-(diaminomethylideneamino) 1-O-ethyl oxalate has a molecular weight of 175.14 g/mol, XLogP of -1.72, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(diaminomethylideneamino) 1-O-ethyl oxalate is sourced from PubChem (CID 57134216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).