C7H3F2N3O2 — CID 57134343
5,7-difluoro-1,4-dihydropyrido[3,4-b]pyrazine-2,3-dione (PubChem CID 57134343) has the molecular formula C7H3F2N3O2 and a molecular weight of 199.12 g/mol. Its IUPAC name is 5,7-difluoro-1,4-dihydropyrido[3,4-b]pyrazine-2,3-dione.
| Compound Name | 5,7-difluoro-1,4-dihydropyrido[3,4-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 57134343 |
| Molecular Formula | C7H3F2N3O2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 199.02 |
| IUPAC Name | 5,7-difluoro-1,4-dihydropyrido[3,4-b]pyrazine-2,3-dione |
| SMILES | O=c1[nH]c2cc(F)nc(F)c2[nH]c1=O |
| InChI | InChI=1S/C7H3F2N3O2/c8-3-1-2-4(5(9)11-3)12-7(14)6(13)10-2/h1H,(H,10,13)(H,12,14) |
| InChIKey | RQKMATWVOFPPLO-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 78.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|